CAS 90410-27-8

N-[(4-chlorophenyl)sulfonyl]alanine

Description:

N-[(4-chlorophenyl)sulfonyl]alanine is an organic compound characterized by the presence of an alanine amino acid structure modified with a sulfonyl group attached to a 4-chlorophenyl moiety. This compound features a sulfonamide functional group, which is known for its ability to form hydrogen bonds and participate in various chemical reactions. The presence of the 4-chlorophenyl group contributes to its hydrophobic characteristics, while the sulfonyl group enhances its solubility in polar solvents. The compound may exhibit biological activity, potentially acting as an inhibitor or modulator in biochemical pathways, making it of interest in pharmaceutical research. Its molecular structure allows for interactions with biological targets, which can be explored for therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by the surrounding pH and temperature conditions. Overall, N-[(4-chlorophenyl)sulfonyl]alanine represents a versatile chemical entity with potential utility in medicinal chemistry and related fields.

Formula: C₉H₁₀ClNO₄S

InChI: InChI=1/C9H10ClNO4S/c1-6(9(12)13)11-16(14,15)8-4-2-7(10)3-5-8/h2-6,11H,1H3,(H,12,13)

SMILES: CC(C(=O)O)NS(=O)(=O)c1ccc(cc1)Cl

Synonyms:

• alanine, N-[(4-chlorophenyl)sulfonyl]-
• N-[(4-Chlorophenyl)sulfonyl]alanine