CAS 90411-12-4
:Neochamaejasmin B
Description:
Neochamaejasmin B is a chemical compound classified as a flavonoid, specifically a type of chalcone. It is derived from natural sources, often found in various plants, and is known for its potential biological activities. The compound exhibits antioxidant properties, which may contribute to its role in protecting cells from oxidative stress. Additionally, Neochamaejasmin B has been studied for its anti-inflammatory and antimicrobial effects, making it of interest in pharmacological research. Its structure typically features a characteristic flavonoid backbone, which is responsible for its diverse biological activities. The compound's solubility and stability can vary depending on the solvent and environmental conditions, influencing its applications in both research and potential therapeutic contexts. As with many natural products, further studies are necessary to fully elucidate its mechanisms of action and potential health benefits.
Formula:C30H22O10
InChI:InChI=1/C30H22O10/c31-15-5-1-13(2-6-15)29-25(27(37)23-19(35)9-17(33)11-21(23)39-29)26-28(38)24-20(36)10-18(34)12-22(24)40-30(26)14-3-7-16(32)8-4-14/h1-12,25-26,29-36H/t25-,26-,29-,30+/s2
InChI key:InChIKey=RNQBLQALVMHBKH-HPZZALBMNA-N
SMILES:O=C1[C@]([C@@H](OC=2C1=C(O)C=C(O)C2)C3=CC=C(O)C=C3)([C@]4([C@H](OC=5C(C4=O)=C(O)C=C(O)C5)C6=CC=C(O)C=C6)[H])[H]
Synonyms:- rel-(+)-(2R,2′S,3R,3′R)-2,2′,3,3′-Tetrahydro-5,5′,7,7′-tetrahydroxy-2,2′-bis(4-hydroxyphenyl)[3,3′-bi-4H-1-benzopyran]-4,4′-dione
- (+)-Neochamaejasmin B
- [3,3′-Bi-4H-1-benzopyran]-4,4′-dione, 2,2′,3,3′-tetrahydro-5,5′,7,7′-tetrahydroxy-2,2′-bis(4-hydroxyphenyl)-, [2α,3α(2′S*,3′R*)]-(+)-
- [3,3′-Bi-4H-1-benzopyran]-4,4′-dione, 2,2′,3,3′-tetrahydro-5,5′,7,7′-tetrahydroxy-2,2′-bis(4-hydroxyphenyl)-, (2R,2′S,3R,3′R)-rel-(+)-
- Neochamaejasmin B
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Neochamaejasmine B
CAS:Neochamaejasmine B displays nematicidal activity against both Bursaphelenchus xylophilus and Bursaphelenchus mucronatus.Formula:C30H22O10Purity:97.89%Color and Shape:SolidMolecular weight:542.49Neochamaejasmine B
CAS:<p>Neochamaejasmine B is a natural bioactive compound, which is derived from the roots of Stellera chamaejasme L., a plant found in various regions of Asia. This compound is classified as a flavonoid, known for its diverse range of biological activities. Its mode of action involves interacting with cellular pathways that regulate processes such as inflammation, cell proliferation, and apoptosis. This multifaceted activity makes Neochamaejasmine B an attractive candidate for research into potential therapeutic applications. Studies have highlighted its potential in the treatment of conditions such as cancer, due to its ability to inhibit specific cancer cell lines, as well as its anti-inflammatory properties which could be beneficial in chronic inflammatory diseases. As research advances, further elucidation of its molecular mechanisms and therapeutic efficacy is anticipated, contributing valuable insights into its application in medicinal chemistry and pharmacology.</p>Formula:C30H22O10Purity:Min. 95%Molecular weight:542.5 g/mol




