CymitQuimica logo

CAS 90415-32-0

:

5,6-Dichloro-4-hydroxy-3-cinnolinecarboxylic acid

Description:
5,6-Dichloro-4-hydroxy-3-cinnolinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cinnoline ring system substituted with two chlorine atoms and a hydroxyl group. This compound typically exhibits properties associated with both acidic and aromatic functionalities, making it potentially useful in various chemical applications, including pharmaceuticals and agrochemicals. The presence of the carboxylic acid group contributes to its acidity, while the hydroxyl group can participate in hydrogen bonding, influencing its solubility and reactivity. The dichloro substitutions can enhance the compound's biological activity and stability. Additionally, the compound may exhibit specific spectral characteristics in techniques such as UV-Vis and NMR spectroscopy, aiding in its identification and analysis. Its synthesis and handling require careful consideration of safety protocols due to the presence of chlorine, which can pose health risks. Overall, 5,6-Dichloro-4-hydroxy-3-cinnolinecarboxylic acid represents a versatile compound with potential applications in various fields of chemistry.
Formula:C9H4Cl2N2O3
InChI:InChI=1S/C9H4Cl2N2O3/c10-3-1-2-4-5(6(3)11)8(14)7(9(15)16)13-12-4/h1-2H,(H,12,14)(H,15,16)
InChI key:InChIKey=FZEUJWZOBXKYSD-UHFFFAOYSA-N
SMILES:OC=1C2=C(N=NC1C(O)=O)C=CC(Cl)=C2Cl
Synonyms:
  • 3-Cinnolinecarboxylic acid, 5,6-dichloro-4-hydroxy-
  • 5,6-Dichloro-4-hydroxy-3-cinnolinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.