CAS 90416-32-3

3-Chloro-4-propoxybenzenethiol

Description:

3-Chloro-4-propoxybenzenethiol, with the CAS number 90416-32-3, is an organic compound characterized by the presence of a thiol (-SH) functional group, a chloro substituent, and a propoxy group attached to a benzene ring. This compound features a chlorinated aromatic system, which can influence its reactivity and solubility. The thiol group contributes to its potential as a nucleophile in various chemical reactions, while the propoxy group enhances its hydrophobic character, affecting its solubility in organic solvents. The presence of the chlorine atom can also impart unique electronic properties, making it useful in synthetic organic chemistry. Additionally, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and materials science. Safety considerations should be taken into account due to the potential toxicity associated with thiols and halogenated compounds. Overall, 3-Chloro-4-propoxybenzenethiol is a versatile compound with applications in various chemical processes and research fields.

Formula: C₉H₁₁ClOS

InChI: InChI=1S/C9H11ClOS/c1-2-5-11-9-4-3-7(12)6-8(9)10/h3-4,6,12H,2,5H2,1H3

InChI key: InChIKey=PJJFLPHAYDTIRF-UHFFFAOYSA-N

SMILES: O(CCC)C1=C(Cl)C=C(S)C=C1

Synonyms:

• Benzenethiol, 3-chloro-4-propoxy-
• 3-Chloro-4-n-propoxythiophenol
• 3-Chloro-4-propoxybenzene-1-thiol
• 3-Chloro-4-propoxybenzenethiol