CAS 90417-27-9
:8-Methoxy-4-cinnolinol
Description:
8-Methoxy-4-cinnolinol, identified by its CAS number 90417-27-9, is a chemical compound characterized by its unique structure, which includes a cinnolinol moiety with a methoxy group at the 8-position. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. It is often studied for its pharmacological properties, including potential anti-inflammatory and antimicrobial effects. The presence of the methoxy group can influence its solubility and reactivity, making it a subject of interest in medicinal chemistry. Additionally, 8-Methoxy-4-cinnolinol may participate in various chemical reactions, such as electrophilic substitutions or nucleophilic attacks, due to the electron-donating nature of the methoxy group. Its synthesis and characterization are important for understanding its applications in drug development and other chemical research areas. As with many organic compounds, safety and handling precautions should be observed when working with this substance in a laboratory setting.
Formula:C9H8N2O2
InChI:InChI=1S/C9H8N2O2/c1-13-8-4-2-3-6-7(12)5-10-11-9(6)8/h2-5H,1H3,(H,11,12)
InChI key:InChIKey=VCZBHAXHTXDOHL-UHFFFAOYSA-N
SMILES:O(C)C=1C2=C(C(O)=CN=N2)C=CC1
Synonyms:- 4-Cinnolinol, 8-methoxy-
- 4-Hydroxy-8-methoxycinnoline
- 8-Methoxy-4-cinnolinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.