CAS 90418-57-8
:4-Cinnolinecarboxaldehyde
Description:
4-Cinnolinecarboxaldehyde is an organic compound characterized by its cinnoline structure, which consists of a fused bicyclic system containing both a pyridine and a pyrazole ring. This compound features an aldehyde functional group (-CHO) attached to the fourth position of the cinnoline ring, contributing to its reactivity and potential applications in organic synthesis. It is typically a yellow to brown solid at room temperature and is soluble in organic solvents such as ethanol and acetone. The presence of the aldehyde group makes it a versatile intermediate in the synthesis of various pharmaceuticals and agrochemicals. Additionally, 4-Cinnolinecarboxaldehyde can participate in various chemical reactions, including condensation and nucleophilic addition, making it valuable in the development of new materials and compounds. Its unique structure and functional groups also lend it potential biological activity, although specific biological properties would require further investigation. As with many organic compounds, proper handling and safety precautions should be observed due to its chemical reactivity.
Formula:C9H6N2O
InChI:InChI=1/C9H6N2O/c12-6-7-5-10-11-9-4-2-1-3-8(7)9/h1-6H
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Cinnolinecarboxaldehyde
CAS:4-Cinnolinecarboxaldehyde is an organic compound that belongs to the group of cinnoline. It is a colorless liquid that can be used as a precursor in the production of aluminum metal. 4-Cinnolinecarboxaldehyde reacts with lithium aluminum hydride to form a compound that can be used as a reducing agent in organic chemistry. 4-Cinnolinecarboxaldehyde is also used as a precursor for preparing other compounds, such as lithium aluminum hydride and lithium aluminum trihydride.
Formula:C9H6N2OPurity:Min. 95%Molecular weight:158.16 g/mol


