CAS 90429-09-7

(4-formyl-2-methoxy-5-nitrophenoxy)acetic acid

Description:

(4-formyl-2-methoxy-5-nitrophenoxy)acetic acid, identified by its CAS number 90429-09-7, is an organic compound characterized by its complex structure, which includes a phenolic moiety substituted with a formyl group, a methoxy group, and a nitro group. This compound typically exhibits a yellow to orange color due to the presence of the nitro group, which can also influence its reactivity and solubility in various solvents. It is likely to be soluble in polar organic solvents, while its acidic carboxylic group may impart some degree of solubility in water. The presence of multiple functional groups suggests that it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations for its practical applications.

Formula: C₁₀H₉NO₇

InChI: InChI=1/C10H9NO7/c1-17-8-2-6(4-12)7(11(15)16)3-9(8)18-5-10(13)14/h2-4H,5H2,1H3,(H,13,14)

SMILES: COc1cc(C=O)c(cc1OCC(=O)O)N(=O)=O

Synonyms:

• Acetic acid, (4-formyl-2-methoxy-5-nitrophenoxy)-

2-(4-Formyl-2-methoxy-5-nitrophenoxy)acetic acid

CAS: 90429-09-7

Formula: C₁₀H₉NO₇

Color and Shape: Solid

Molecular weight: 255.1810

Ref: IN-DA01ABIL

2-(4-Formyl-2-methoxy-5-nitrophenoxy)acetic acid

CAS: 90429-09-7

2-(4-Formyl-2-methoxy-5-nitrophenoxy)acetic acid

Purity: 95%

Molecular weight: 255.18g/mol

Ref: 54-OR1054303

4-Formyl-6-methoxy-3-nitrophenoxyacetic acid

CAS: 90429-09-7

4-Formyl-6-methoxy-3-nitrophenoxyacetic acid is a photolabile formylated nitrophenol that is used to study the formation of concentration gradients across cell membranes. 4-Formyl-6-methoxy-3-nitrophenoxyacetic acid has been found to react with proton gradients and formyl groups in the membrane, which produces formaldehyde. The reaction mechanism for this process is not well understood, but it has been proposed that the reaction proceeds through a transducing step in which an electron from the formyl group reacts with a proton gradient to produce a formate ion. This mechanism is supported by experiments that show that the rate of photochemical reactions increases as the pH gradient across the membrane decreases.

Formula: C₁₀H₉NO₇

Purity: Min. 95%

Molecular weight: 255.18 g/mol

Ref: 3D-QDA42909