CAS 904311-15-5

4-amino-5-chloro-6-ethoxypyridine-2-carboxylic acid

Description:

4-Amino-5-chloro-6-ethoxypyridine-2-carboxylic acid is a chemical compound characterized by its pyridine ring structure, which is substituted with an amino group, a chloro group, and an ethoxy group, along with a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in various solvents. The presence of the amino group suggests basic characteristics, while the carboxylic acid group imparts acidic properties. The chloro substituent can influence the compound's reactivity and stability, making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the ethoxy group enhances solubility in organic solvents and may affect the compound's biological activity. This compound may be of interest in pharmaceutical research and development due to its potential applications in medicinal chemistry. As with many pyridine derivatives, it may exhibit biological activity, making it a subject of study in drug design and synthesis.

Formula: C₈H₉ClN₂O₃

InChI: InChI=1/C8H9ClN2O3/c1-2-14-7-6(9)4(10)3-5(11-7)8(12)13/h3H,2H2,1H3,(H2,10,11)(H,12,13)

Synonyms:

• 2-Pyridinecarboxylic acid, 4-amino-5-chloro-6-ethoxy-
• 4-Amino-5-chloro-6-ethoxypyridine-2-carboxylic acid
• 4-AMINO-5-CHLORO-6-ETHOXYPICOLINIC ACID
• 4-Amino-5-chloro-6-ethoxy-2-pyridinecarboxylic acid

4-Amino-5-chloro-6-ethoxypicolinic acid

CAS: 904311-15-5

Formula: C₈H₉ClN₂O₃

Molecular weight: 216.6217

Ref: IN-DA00H1NJ