CAS 90433-26-4

4-(3-methylbut-3-en-1-yl)benzonitrile

Description:

4-(3-Methylbut-3-en-1-yl)benzonitrile, identified by its CAS number 90433-26-4, is an organic compound characterized by the presence of a benzonitrile moiety and a branched alkene substituent. This compound features a nitrile functional group (-C≡N) attached to a benzene ring, which contributes to its aromatic properties and potential reactivity. The 3-methylbut-3-en-1-yl group introduces a degree of unsaturation and steric hindrance, influencing its physical and chemical properties. Typically, compounds of this nature exhibit moderate polarity due to the presence of the nitrile group, which can engage in hydrogen bonding and dipole-dipole interactions. The compound may be used in various applications, including organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. Its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₁₂H₁₃N

InChI: InChI=1/C12H13N/c1-10(2)3-4-11-5-7-12(9-13)8-6-11/h5-8H,1,3-4H2,2H3

SMILES: C=C(C)CCc1ccc(cc1)C#N