CAS 90434-92-7

4,5,6,7-tetrahydro-1H-indazole-3-carbohydrazide

Description:

4,5,6,7-Tetrahydro-1H-indazole-3-carbohydrazide is a chemical compound characterized by its unique bicyclic structure, which includes an indazole moiety. This compound features a hydrazide functional group, contributing to its potential reactivity and biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents, depending on the specific conditions. The presence of the hydrazide group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as hydrazides are known for their diverse biological activities, including antimicrobial and anti-inflammatory properties. Additionally, the tetrahydroindazole framework may impart interesting pharmacological effects, making this compound a subject of interest in drug discovery. Its CAS number, 90434-92-7, allows for easy identification in chemical databases and literature. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound may not be fully characterized.

Formula: C₈H₁₂N₄O

InChI: InChI=1/C8H12N4O/c9-10-8(13)7-5-3-1-2-4-6(5)11-12-7/h1-4,9H2,(H,10,13)(H,11,12)

SMILES: C1CCc2c(C1)c(C(=O)NN)n[nH]2

Synonyms:

• 1H-indazole-3-carboxylic acid, 4,5,6,7-tetrahydro-, hydrazide

4,5,6,7-Tetrahydro-1H-indazole-3-carbohydrazide

CAS: 90434-92-7

4,5,6,7-Tetrahydro-1H-indazole-3-carbohydrazide

Purity: ≥95%

Molecular weight: 180.21g/mol

Ref: 54-OR303971