CAS 90436-14-9

8-Azabicyclo[3.2.1]octane, 3-(chloromethyl)-8-methyl-, hydrochloride (1:1)

Description:

8-Azabicyclo[3.2.1]octane, 3-(chloromethyl)-8-methyl-, hydrochloride (1:1), with the CAS number 90436-14-9, is a bicyclic compound characterized by its unique structure that includes a nitrogen atom within a bicyclic framework. This compound features a chloromethyl group at the 3-position and a methyl group at the 8-position of the bicyclic system, contributing to its reactivity and potential biological activity. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents. The presence of the azabicyclic structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The compound's properties, such as melting point, solubility, and stability, can vary based on environmental conditions and the presence of other substances. Overall, this compound represents a significant interest in the field of organic and medicinal chemistry due to its structural features and potential applications.

Formula: C₉H₁₆ClN·ClH

InChI: InChI=1S/C9H16ClN.ClH/c1-11-8-2-3-9(11)5-7(4-8)6-10;/h7-9H,2-6H2,1H3;1H

InChI key: InChIKey=YXOFKFOQBVMWPC-UHFFFAOYSA-N

SMILES: CN1C2CC(CCl)CC1CC2.Cl

Synonyms:

• 8-Azabicyclo[3.2.1]octane, 3-(chloromethyl)-8-methyl-, hydrochloride (1:1)
• Tropane, 3-(chloromethyl)-, hydrochloride