CAS 904369-20-6

7-Bromo-2-quinolinecarboxaldehyde

Description:

7-Bromo-2-quinolinecarboxaldehyde is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a bromine atom at the 7-position and an aldehyde functional group at the 2-position significantly influences its chemical reactivity and properties. This compound typically appears as a solid or crystalline substance and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The bromine substituent can enhance the compound's reactivity, making it useful in various synthetic pathways, including cross-coupling reactions. Additionally, the aldehyde group can participate in condensation reactions, further expanding its utility in organic synthesis. As with many halogenated compounds, 7-Bromo-2-quinolinecarboxaldehyde may exhibit unique physical properties, such as solubility in organic solvents, and may require careful handling due to potential toxicity or environmental concerns.

Formula: C₁₀H₆BrNO

InChI: InChI=1S/C10H6BrNO/c11-8-3-1-7-2-4-9(6-13)12-10(7)5-8/h1-6H

InChI key: InChIKey=UAAIYUWCJFTSAF-UHFFFAOYSA-N

SMILES: C(=O)C1=NC2=C(C=C1)C=CC(Br)=C2

Synonyms:

• 7-Bromoquinoline-2-carboxaldehyde
• 2-Quinolinecarboxaldehyde, 7-bromo-
• 7-Bromo-2-quinolinecarboxaldehyde

7-bromoquinoline-2-carbaldehyde

CAS: 904369-20-6

Versatile small molecule scaffold

Formula: C₁₀H₆BrNO

Purity: Min. 95%

Molecular weight: 236.1 g/mol

Ref: 3D-ELB36920