CAS 904369-49-9

6-bromo-4-chloro-quinoline-2-carbaldehyde

Description:

6-Bromo-4-chloro-quinoline-2-carbaldehyde is an organic compound characterized by its heterocyclic structure, which includes a quinoline ring system. This compound features both bromine and chlorine substituents, contributing to its reactivity and potential applications in various chemical reactions. The presence of the aldehyde functional group (-CHO) indicates that it can participate in further chemical transformations, such as condensation reactions or nucleophilic additions. The bromine and chlorine atoms can influence the compound's electronic properties, making it useful in medicinal chemistry and material science. Additionally, the compound may exhibit biological activity, which is often explored in drug development. Its unique structure allows for potential interactions with biological targets, making it a subject of interest in pharmacological research. Overall, 6-bromo-4-chloro-quinoline-2-carbaldehyde is a versatile compound with significant implications in synthetic chemistry and biological applications.

Formula: C₁₀H₅BrClNO

InChI: InChI=1/C10H5BrClNO/c11-6-1-2-10-8(3-6)9(12)4-7(5-14)13-10/h1-5H

SMILES: c1cc2c(cc1Br)c(cc(C=O)n2)Cl

Synonyms:

• 2-Quinolinecarboxaldehyde, 6-Bromo-4-Chloro-
• 6-Bromo-4-chloroquinoline-2-carbaldehyde

6-Bromo-4-chloroquinoline-2-carboxaldehyde

CAS: 904369-49-9

6-Bromo-4-chloroquinoline-2-carboxaldehyde

Purity: ≥95%

Molecular weight: 270.51g/mol

Ref: 54-OR307876