CAS 90456-53-4

6,8-Bis(β-D-glucopyranosyloxy)-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one

Description:

6,8-Bis(β-D-glucopyranosyloxy)-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one, with CAS number 90456-53-4, is a flavonoid glycoside characterized by its complex structure, which includes multiple hydroxyl groups and glycosidic linkages. This compound features a benzopyran backbone, which is typical of flavonoids, contributing to its potential antioxidant properties. The presence of β-D-glucopyranosyl groups enhances its solubility in water and may influence its bioavailability and pharmacological activities. The hydroxyl groups on the benzopyran structure are known to participate in various chemical reactions, potentially providing the compound with anti-inflammatory and anticancer properties. Additionally, the presence of the 4-hydroxyphenyl group may contribute to its ability to scavenge free radicals. Overall, this compound is of interest in the fields of medicinal chemistry and natural product research, particularly for its potential health benefits and applications in nutraceuticals.

Formula: C₂₇H₃₀O₁₇

InChI: InChI=1S/C27H30O17/c28-6-12-15(32)18(35)20(37)26(41-12)43-24-17(34)14-10(31)5-11(8-1-3-9(30)4-2-8)40-23(14)25(22(24)39)44-27-21(38)19(36)16(33)13(7-29)42-27/h1-5,12-13,15-16,18-21,26-30,32-39H,6-7H2/t12-,13-,15-,16-,18+,19+,20-,21-,26+,27+/m1/s1

InChI key: InChIKey=CSNXTSWTBUEIJB-PXJYGDGDSA-N

SMILES: O(C1=C2C(=C(O)C(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)=C1O)C(=O)C=C(O2)C4=CC=C(O)C=C4)[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O

Synonyms:

• 4H-1-Benzopyran-4-one, 6,8-bis(β-D-glucopyranosyloxy)-5,7-dihydroxy-2-(4-hydroxyphenyl)-
• 6,8-Bis(β-D-glucopyranosyloxy)-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one

4H-1-Benzopyran-4-one, 6,8-bis(β-D-glucopyranosyloxy)-5,7-dihydroxy-2-(4-hydroxyphenyl)-

CAS: 90456-53-4

Formula: C₂₇H₃₀O₁₇

Purity: 97%

Color and Shape: Solid

Molecular weight: 626.5169

Ref: IN-DA01Q92W

Vicinin 2

CAS: 90456-53-4

Vicinin 2 is a bioactive compound, specifically a therapeutic agent, which is derived from natural plant sources. This product is characterized by its ability to interact directly with specific biological pathways, demonstrating a targeted mode of action. Vicinin 2 modulates key cellular activities by binding to receptors or enzymes involved in these pathways, resulting in altered downstream signaling and physiological effects.

Formula: C₂₇H₃₀O₁₇

Purity: Min. 95%

Molecular weight: 626.5 g/mol

Ref: 3D-QDA45653