CymitQuimica logo

CAS 90459-39-5

:

Nonanoic acid, reaction products with diethanolamine

Description:
Nonanoic acid, reaction products with diethanolamine, identified by CAS number 90459-39-5, is a chemical compound formed through the reaction of nonanoic acid, a nine-carbon fatty acid, with diethanolamine, a diol amine. This substance typically exhibits characteristics associated with both its fatty acid and amine components, such as being a viscous liquid or semi-solid at room temperature. It is likely to have surfactant properties due to the presence of both hydrophobic (nonanoic acid) and hydrophilic (diethanolamine) regions, making it useful in various applications, including emulsifiers, dispersants, and corrosion inhibitors. The compound may also possess mild to moderate toxicity, and its safety profile would need to be assessed for specific applications. Additionally, it may have a characteristic odor associated with fatty acids. As with many chemical substances, handling should be done with care, following appropriate safety guidelines to mitigate any potential risks.
Formula:C9H18O2·C4H11NO2
InChI:InChI=1S/C9H18O2.C4H11NO2/c1-2-3-4-5-6-7-8-9(10)11;6-3-1-5-2-4-7/h2-8H2,1H3,(H,10,11);5-7H,1-4H2
InChI key:InChIKey=NUDYKAHLTJJPII-UHFFFAOYSA-N
SMILES:C(CCCCC)CCC(O)=O.N(CCO)CCO
Synonyms:
  • Nonanoic acid, reaction products with diethanolamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.