CymitQuimica logo

CAS 904633-30-3

:

ethyl 2-(thiophene-3-carbonyl)benzoate

Description:
Ethyl 2-(thiophene-3-carbonyl)benzoate is an organic compound characterized by its ester functional group, which is formed from the reaction of benzoic acid and ethanol. This compound features a thiophene ring, a five-membered aromatic heterocycle containing sulfur, which contributes to its unique chemical properties and potential reactivity. The presence of the carbonyl group adjacent to the thiophene enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic additions. Ethyl 2-(thiophene-3-carbonyl)benzoate may exhibit moderate solubility in organic solvents, and its structure suggests potential applications in organic synthesis, pharmaceuticals, and materials science. Additionally, the compound's aromatic nature may impart stability and influence its interaction with biological systems. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Overall, this compound represents a versatile building block in organic chemistry with potential applications in various fields.
Formula:C14H12O3S
InChI:InChI=1/C14H12O3S/c1-2-17-14(16)12-6-4-3-5-11(12)13(15)10-7-8-18-9-10/h3-9H,2H2,1H3
SMILES:CCOC(=O)c1ccccc1C(=O)c1ccsc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.