CAS 90471-66-2

4-[(benzyloxy)carbonyl]thiomorpholine-3-carboxylic acid

Description:

4-[(Benzyloxy)carbonyl]thiomorpholine-3-carboxylic acid is a chemical compound characterized by its unique structure, which includes a thiomorpholine ring, a benzyloxycarbonyl group, and a carboxylic acid functional group. This compound typically exhibits properties associated with both heterocyclic compounds and carboxylic acids, such as solubility in polar solvents and potential reactivity due to the presence of the carboxylic acid group. The thiomorpholine ring contributes to its cyclic nature, which can influence its biological activity and interaction with other molecules. The benzyloxy group enhances lipophilicity, potentially affecting its pharmacokinetic properties. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could facilitate interactions with biological targets. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including protection and deprotection strategies for functional groups. Overall, 4-[(benzyloxy)carbonyl]thiomorpholine-3-carboxylic acid represents a versatile scaffold for further chemical modifications and applications in drug design.

Formula: C₁₃H₁₅NO₄S

InChI: InChI=1/C13H15NO4S/c15-12(16)11-9-19-7-6-14(11)13(17)18-8-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,15,16)

SMILES: c1ccc(cc1)COC(=O)N1CCSCC1C(=O)O

Synonyms:

• 3,4-Thiomorpholinedicarboxylic Acid, 4-(Phenylmethyl) Ester
• Acide 4-[(Benzyloxy)Carbonyl]Thiomorpholine-3-Carboxylique