CAS 90471-79-7
:L-Carnitine acid fumarate
Description:
L-Carnitine acid fumarate is a compound that combines L-carnitine, a naturally occurring amino acid derivative, with fumaric acid, a dicarboxylic acid involved in the Krebs cycle. This substance is often used as a dietary supplement, particularly in the context of enhancing athletic performance and supporting fat metabolism. L-Carnitine plays a crucial role in the transport of fatty acids into the mitochondria, where they are oxidized for energy production. The fumarate component may contribute to the compound's stability and bioavailability. L-Carnitine acid fumarate is typically characterized by its white to off-white crystalline appearance and is soluble in water, which facilitates its absorption in the body. It is generally regarded as safe when used appropriately, though potential side effects may include gastrointestinal discomfort. As with any supplement, it is advisable to consult healthcare professionals before use, especially for individuals with underlying health conditions or those taking other medications.
Formula:C7H16NO3·C4H3O4
InChI:InChI=1/C7H15NO3.C4H4O4/c1-8(2,3)5-6(9)4-7(10)11;5-3(6)1-2-4(7)8/h6,9H,4-5H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t6-;/m1./s1
SMILES:C([N+](C)(C)C)[C@@H](CC(O)=O)O.C(=C/C(O)=O)\C([O-])=O
Synonyms:- (3R)-3-hydroxy-4-(trimethylammonio)butanoate (2Z)-but-2-enedioate (salt)
- (R)-(3-Carboxy-2-hydroxypropyl)-trimethyl ammonium fumarate
- 1-Propanaminium, 3-carboxy-2-hydroxy-N,N,N-trimethyl-, (2R)-, (2E)-2-butenedioate (1:1)
- 1-Propanaminium, 3-carboxy-2-hydroxy-N,N,N-trimethyl-, (2R)-, (2E)-2-butenedioate (1:1) (salt)
- 1-Propanaminium, 3-carboxy-2-hydroxy-N,N,N-trimethyl-, (R)-, (E)-2-butenedioate (1:1) (salt)
- 2-Butenedioic acid (2E)-, ion(1-), (2R)-3-carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium
- 2-Butenedioic acid (E)-, ion(1-), (R)-3-carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium
- <span class="text-smallcaps">L</span>-Carnitine acid fumarate
- L-Carntine Fumarate
- L-(-)-Carnitine fumarate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1-Propanaminium, 3-carboxy-2-hydroxy-N,N,N-trimethyl-, (2R)-,(2E)-2-butenedioate (1:1) (salt)OTHER CA INDEX NAMES:2-Butenedioic acid (2E)-, ion(1-),(2R)-3-carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium
CAS:Formula:C11H19NO7Purity:98%Color and Shape:SolidMolecular weight:277.2711L-Carnitine fumarate
CAS:Formula:C7H15NO3·C4H4O4Purity:97.5 - 102.5 % (L-Carnitine + Fumaric acid, dried basis)Color and Shape:White crystalline powderMolecular weight:277.27L-Carnitine fumarate
CAS:L-Carnitine fumarate is a compound that functions as a dietary supplement, which is synthesized by combining L-carnitine, an amino acid derivative naturally found in the body, with fumaric acid. This product is primarily sourced from fermentation or chemical synthesis processes to produce L-carnitine, which is then reacted with fumaric acid to form the fumarate salt. This combination enhances the stability and bioavailability of L-carnitine.Formula:C7H15NO3·C4H4O4Purity:Min. 95%Molecular weight:277.27 g/mol





