CymitQuimica logo

CAS 90473-00-0

:

ethyl 2-[(Z)-[(1S,2S,5S)-2-hydroxy-2,6,6-trimethyl-norpinan-3-ylidene]amino]acetate

Description:
Ethyl 2-[(Z)-[(1S,2S,5S)-2-hydroxy-2,6,6-trimethyl-norpinan-3-ylidene]amino]acetate, with the CAS number 90473-00-0, is a chemical compound characterized by its complex structure, which includes a norpinane framework and an ethyl acetate moiety. This compound features a stereogenic center, contributing to its chirality, which can influence its biological activity and interactions. The presence of a hydroxyl group indicates potential for hydrogen bonding, enhancing solubility in polar solvents. The Z-configuration of the double bond suggests specific spatial arrangements that may affect its reactivity and binding properties. Ethyl 2-[(Z)-[(1S,2S,5S)-2-hydroxy-2,6,6-trimethyl-norpinan-3-ylidene]amino]acetate may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis and characterization would typically involve techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm purity and structural integrity. Overall, this compound represents a unique blend of structural features that could be explored for various applications in chemical and pharmaceutical research.
Formula:C14H23NO3
InChI:InChI=1/C14H23NO3/c1-5-18-12(16)8-15-11-7-9-6-10(13(9,2)3)14(11,4)17/h9-10,17H,5-8H2,1-4H3/b15-11-/t9-,10-,14-/m0/s1
SMILES:CCOC(=O)C/N=C\1/C[C@@H]2C[C@@H](C2(C)C)[C@]1(C)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.