
CAS 90474-14-9
:4-Methylene-1,2-cyclopentanedicarboxylic acid
Description:
4-Methylene-1,2-cyclopentanedicarboxylic acid, with the CAS number 90474-14-9, is an organic compound characterized by its unique bicyclic structure featuring a methylene group and two carboxylic acid functional groups. This compound typically appears as a colorless to pale yellow solid and is soluble in polar solvents due to the presence of the carboxylic acid groups. Its molecular structure contributes to its reactivity, making it a potential candidate for various chemical reactions, including esterification and polymerization. The presence of the methylene bridge enhances its stability and can influence its physical properties, such as melting and boiling points. Additionally, 4-Methylene-1,2-cyclopentanedicarboxylic acid may exhibit interesting biological activities, which could be explored for applications in pharmaceuticals or agrochemicals. As with many organic acids, it is important to handle this compound with care, as it may be corrosive and can cause irritation upon contact with skin or mucous membranes.
Formula:C8H10O4
InChI:InChI=1S/C8H10O4/c1-4-2-5(7(9)10)6(3-4)8(11)12/h5-6H,1-3H2,(H,9,10)(H,11,12)
InChI key:InChIKey=WRJRZNHDCDDIFH-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C(C(O)=O)CC(=C)C1
Synonyms:- 4-Methylene-1,2-cyclopentanedicarboxylic acid
- 1,2-Cyclopentanedicarboxylic acid, 4-methylene-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
