CAS 904745-60-4
:3-Bromo-2-chloro-5-(chloromethyl)pyridine
Description:
3-Bromo-2-chloro-5-(chloromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features multiple halogen substituents, specifically bromine and chlorine, which can significantly influence its reactivity and physical properties. The presence of the chloromethyl group enhances its potential for further chemical modifications, making it a valuable intermediate in organic synthesis. Typically, compounds like this exhibit moderate to high polarity due to the electronegative halogen atoms, which can affect solubility in various solvents. Additionally, the halogen substituents can impart unique biological activities, making such compounds of interest in medicinal chemistry and agrochemicals. The compound's structure suggests it may participate in nucleophilic substitution reactions, and its reactivity can be influenced by the electronic effects of the halogens. Overall, 3-Bromo-2-chloro-5-(chloromethyl)pyridine is a versatile compound with applications in synthetic chemistry and potential biological relevance.
Formula:C6H4BrCl2N
InChI:InChI=1S/C6H4BrCl2N/c7-5-1-4(2-8)3-10-6(5)9/h1,3H,2H2
InChI key:InChIKey=QLDHITAFZVTABS-UHFFFAOYSA-N
SMILES:C(Cl)C=1C=C(Br)C(Cl)=NC1
Synonyms:- Pyridine, 3-bromo-2-chloro-5-(chloromethyl)-
- 3-Bromo-2-chloro-5-(chloromethyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
