CAS 904766-63-8

4-[(2-fluoro-5-methylphenyl)amino]-4-oxobutanoic acid

Description:

4-[(2-Fluoro-5-methylphenyl)amino]-4-oxobutanoic acid, identified by its CAS number 904766-63-8, is an organic compound characterized by its unique functional groups and structural features. It contains an amino group, a ketone, and a carboxylic acid, which contribute to its reactivity and potential biological activity. The presence of the 2-fluoro-5-methylphenyl moiety suggests that the compound may exhibit specific interactions with biological targets, potentially influencing its pharmacological properties. The molecular structure indicates that it may participate in hydrogen bonding due to the carboxylic acid and amino groups, enhancing its solubility in polar solvents. Additionally, the fluorine atom can affect the compound's lipophilicity and metabolic stability. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the context of designing molecules with targeted biological activity. Further studies would be necessary to elucidate its specific properties, including its synthesis, stability, and potential applications.

Formula: C₁₁H₁₂FNO₃

InChI: InChI=1/C11H12FNO3/c1-7-2-3-8(12)9(6-7)13-10(14)4-5-11(15)16/h2-3,6H,4-5H2,1H3,(H,13,14)(H,15,16)

SMILES: Cc1ccc(c(c1)N=C(CCC(=O)O)O)F

Synonyms:

• Butanoic Acid, 4-[(2-Fluoro-5-Methylphenyl)Amino]-4-Oxo-

4-[(2-fluoro-5-methylphenyl)amino]-4-oxobutanoic acid

CAS: 904766-63-8

Formula: C₁₁H₁₂FNO₃

Purity: 95.0%

Molecular weight: 225.219

Ref: 10-F315809