CymitQuimica logo

CAS 90480-21-0

:

9-Octadecenoic acid (9Z)-, reaction products with diethylenetriamine

Description:
9-Octadecenoic acid (9Z)-, reaction products with diethylenetriamine, identified by CAS number 90480-21-0, is a chemical compound formed through the reaction of oleic acid (a monounsaturated fatty acid) and diethylenetriamine, a polyamine. This substance typically exhibits characteristics associated with both fatty acids and amines, including potential surfactant properties due to its amphiphilic nature. It may present as a viscous liquid or solid, depending on the specific formulation and conditions. The presence of both long hydrocarbon chains and amine groups suggests that it can interact with various surfaces and materials, making it useful in applications such as emulsifiers, dispersants, or corrosion inhibitors. Additionally, the compound may exhibit biological activity, which could be relevant in pharmaceutical or agricultural contexts. Safety and handling considerations should be taken into account, as with many amine-containing compounds, due to potential irritant properties. Overall, this substance represents a unique combination of fatty acid and amine characteristics, leading to diverse applications in industrial and commercial settings.
Formula:C18H34O2·C4H13N3
InChI:InChI=1S/C18H34O2.C4H13N3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;5-1-3-7-4-2-6/h9-10H,2-8,11-17H2,1H3,(H,19,20);7H,1-6H2/b10-9-;
InChI key:InChIKey=PYBPYUAKCDQFCS-KVVVOXFISA-N
SMILES:C(C/C=C\CCCCCCCC)CCCCCC(O)=O.N(CCN)CCN
Synonyms:
  • 9-Octadecenoic acid (Z)-, reaction products with diethylenetriamine
  • 9-Octadecenoic acid (9Z)-, reaction products with diethylenetriamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.