CAS 904807-77-8
:4-[(2-tert-butylphenyl)amino]-4-oxobutanoic acid
Description:
4-[(2-tert-butylphenyl)amino]-4-oxobutanoic acid, identified by its CAS number 904807-77-8, is an organic compound characterized by its functional groups and structural features. It contains an amine group, a carbonyl group, and a carboxylic acid, which contribute to its reactivity and potential applications in various chemical processes. The presence of the tert-butyl group enhances its hydrophobic characteristics, while the phenyl ring can provide aromatic stability and influence its solubility in organic solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential for interactions with biological targets, which could be explored in drug development. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application. Overall, 4-[(2-tert-butylphenyl)amino]-4-oxobutanoic acid represents a versatile molecule with potential utility in both synthetic and medicinal chemistry.
Formula:C14H19NO3
InChI:InChI=1/C14H19NO3/c1-14(2,3)10-6-4-5-7-11(10)15-12(16)8-9-13(17)18/h4-7H,8-9H2,1-3H3,(H,15,16)(H,17,18)
SMILES:CC(C)(C)c1ccccc1N=C(CCC(=O)O)O
Synonyms:- Butanoic Acid, 4-[[2-(1,1-Dimethylethyl)Phenyl]Amino]-4-Oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
