CAS 904810-52-2

4-[(4-chloro-2-fluorophenyl)amino]-4-oxobutanoic acid

Description:

4-[(4-chloro-2-fluorophenyl)amino]-4-oxobutanoic acid, identified by its CAS number 904810-52-2, is a chemical compound characterized by its unique structure, which includes an amino group, a chloro-substituted phenyl ring, and a keto acid functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and biological activity. The presence of the chloro and fluoro substituents on the phenyl ring can influence its electronic properties, potentially enhancing its lipophilicity and affecting its interaction with biological targets. As a keto acid, it may participate in various chemical reactions, including decarboxylation and condensation. The compound's specific characteristics, such as solubility, melting point, and stability, can vary based on environmental conditions and the presence of solvents. Due to its structural features, it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways.

Formula: C₁₀H₉ClFNO₃

InChI: InChI=1/C10H9ClFNO3/c11-6-1-2-8(7(12)5-6)13-9(14)3-4-10(15)16/h1-2,5H,3-4H2,(H,13,14)(H,15,16)

SMILES: c1cc(c(cc1Cl)F)N=C(CCC(=O)O)O

Synonyms:

• Butanoic Acid, 4-[(4-Chloro-2-Fluorophenyl)Amino]-4-Oxo-

4-[(4-Chloro-2-fluorophenyl)amino]-4-oxobutanoic acid

CAS: 904810-52-2

Formula: C₁₀H₉ClFNO₃

Molecular weight: 245.6348

Ref: IN-DA006P7Y