CAS 904813-23-6

5-(2-Thienyl)-4H-pyrazole-3-carboxylic acid

Description:

5-(2-Thienyl)-4H-pyrazole-3-carboxylic acid is an organic compound characterized by its unique structure, which includes a pyrazole ring fused with a thienyl group. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the thienyl moiety imparts distinct electronic and steric characteristics, which can influence its reactivity and interactions with other molecules. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure allows for potential hydrogen bonding due to the carboxylic acid, which can enhance solubility in polar solvents. Additionally, the compound may participate in various chemical reactions, such as esterification or amidation, due to the reactive carboxylic acid group. Its specific applications and behavior in biological systems would depend on further studies, including pharmacological evaluations and synthesis methods. Overall, 5-(2-Thienyl)-4H-pyrazole-3-carboxylic acid represents a versatile scaffold for further chemical exploration.

Formula: C₈H₆N₂O₂S

InChI: InChI=1S/C8H6N2O2S/c11-8(12)6-4-5(9-10-6)7-2-1-3-13-7/h1-3H,4H2,(H,11,12)

InChI key: InChIKey=MHFAEIHUZNEIFF-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1CC(=NN1)C2=CC=CS2

Synonyms:

• 4H-Pyrazole-3-carboxylic acid, 5-(2-thienyl)-
• 5-(2-Thienyl)-4H-pyrazole-3-carboxylic acid