CAS 904813-32-7
:N-[1-(3-aminophenyl)ethyl]hydroxylamine
Description:
N-[1-(3-aminophenyl)ethyl]hydroxylamine, with the CAS number 904813-32-7, is an organic compound characterized by the presence of a hydroxylamine functional group attached to an ethyl chain that is further substituted with a 3-aminophenyl group. This compound typically exhibits properties associated with both amines and hydroxylamines, such as the ability to participate in hydrogen bonding due to the hydroxylamine group, which can enhance its solubility in polar solvents. The presence of the amino group on the aromatic ring may contribute to its reactivity, allowing it to engage in various chemical reactions, including nucleophilic substitutions and redox reactions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its stability, reactivity, and potential applications can vary based on environmental conditions such as pH and temperature. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C8H12N2O
InChI:InChI=1/C8H12N2O/c1-6(10-11)7-3-2-4-8(9)5-7/h2-6,10-11H,9H2,1H3
Synonyms:- 3-[1-(hydroxyamino)ethyl]aniline
- 3-[1-(Hydroxyamino)ethyl]anilin
- benzenemethanamine, 3-amino-N-hydroxy-α-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.