CAS 904813-76-9

2-(4-nitrophenyl)-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine

Description:

2-(4-Nitrophenyl)-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine is a chemical compound characterized by its complex bicyclic structure, which includes a benzodiazepine core. This compound features a nitrophenyl substituent at the 2-position, contributing to its unique chemical properties and potential biological activity. The presence of the nitro group typically enhances the compound's reactivity and may influence its pharmacological profile. The tetrahydro configuration indicates that the compound contains saturated rings, which can affect its solubility and stability. This substance may exhibit various interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its CAS number, 904813-76-9, allows for precise identification in chemical databases. As with many benzodiazepine derivatives, it may possess psychoactive properties, but specific biological activities would require further investigation through experimental studies. Safety and handling precautions should be observed due to the potential toxicity associated with nitro-substituted compounds.

Formula: C₁₅H₁₅N₃O₂

InChI: InChI=1/C15H15N3O2/c19-18(20)12-7-5-11(6-8-12)13-9-10-16-14-3-1-2-4-15(14)17-13/h1-8,13,16-17H,9-10H2

SMILES: c1ccc2c(c1)NCCC(c1ccc(cc1)N(=O)=O)N2

Synonyms:

• 1H-1,5-benzodiazepine, 2,3,4,5-tetrahydro-2-(4-nitrophenyl)-
• 2-(4-Nitrophenyl)-2,3,4,5-tetrahydro-1H-1,5-benzodiazepin
• 2-(4-Nitrophenyl)-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine

2-(4-Nitrophenyl)-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine

CAS: 904813-76-9

2-(4-Nitrophenyl)-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine

Purity: ≥95%

Molecular weight: 269.30g/mol

Ref: 54-OR01592

2-(4-nitrophenyl)-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine

CAS: 904813-76-9

Purity: 95.0%

Molecular weight: 269.3039855957031

Ref: 10-F526145