CAS 904813-89-4

2-(1,3-benzodioxol-5-yl)-3-bromo-imidazo[1,2-a]pyridine

Description:

2-(1,3-benzodioxol-5-yl)-3-bromo-imidazo[1,2-a]pyridine is a chemical compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine core fused with a benzodioxole moiety. This compound features a bromine atom at the 3-position of the imidazole ring, contributing to its reactivity and potential biological activity. The presence of the benzodioxole group may enhance its lipophilicity and influence its interaction with biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, including potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. The molecular structure suggests potential for diverse interactions due to the presence of both aromatic and heterocyclic components. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a subject of interest in various chemical and pharmaceutical research fields.

Formula: C₁₄H₉BrN₂O₂

InChI: InChI=1/C14H9BrN2O2/c15-14-13(16-12-3-1-2-6-17(12)14)9-4-5-10-11(7-9)19-8-18-10/h1-7H,8H2

Synonyms:

• 2-(1,3-Benzodioxol-5-yl)-3-bromimidazo[1,2-a]pyridin
• imidazo[1,2-a]pyridine, 2-(1,3-benzodioxol-5-yl)-3-bromo-
• 2-(1,3-Benzodioxol-5-yl)-3-bromoimidazo[1,2-a]pyridine

2-(1,3-Benzodioxol-5-yl)-3-bromoimidazo[1,2-a]pyridine

CAS: 904813-89-4

2-(1,3-Benzodioxol-5-yl)-3-bromoimidazo[1,2-a]pyridine

Purity: ≥95%

Ref: 54-OR11716