CAS 904813-96-3

2-(1,3-benzodioxol-5-yl)-3-bromo-6-chloro-imidazo[1,2-a]pyridine

Description:

2-(1,3-benzodioxol-5-yl)-3-bromo-6-chloro-imidazo[1,2-a]pyridine is a chemical compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine core fused with a benzodioxole moiety. This compound features halogen substituents, specifically bromine and chlorine, which can influence its reactivity and biological activity. The presence of the benzodioxole group often imparts unique electronic properties, potentially enhancing its interaction with biological targets. The imidazo[1,2-a]pyridine framework is known for its presence in various pharmacologically active compounds, suggesting that this substance may exhibit interesting pharmacological properties. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's CAS number, 904813-96-3, serves as a unique identifier for regulatory and safety information. Overall, the characteristics of this compound make it a subject of interest in both synthetic and medicinal chemistry research.

Formula: C₁₄H₈BrClN₂O₂

InChI: InChI=1/C14H8BrClN2O2/c15-14-13(17-12-4-2-9(16)6-18(12)14)8-1-3-10-11(5-8)20-7-19-10/h1-6H,7H2

Synonyms:

• 2-(1,3-Benzodioxol-5-yl)-3-brom-6-chlorimidazo[1,2-a]pyridin

2-(1,3-Benzodioxol-5-yl)-3-bromo-6-chloroimidazo[1,2-a]pyridine

CAS: 904813-96-3

2-(1,3-Benzodioxol-5-yl)-3-bromo-6-chloroimidazo[1,2-a]pyridine

Purity: ≥95%

Ref: 54-OR11718