CAS 904814-03-5

2-(1,3-benzodioxol-5-yl)-3-bromo-6-nitro-imidazo[1,2-a]pyridine

Description:

2-(1,3-benzodioxol-5-yl)-3-bromo-6-nitro-imidazo[1,2-a]pyridine is a chemical compound characterized by its complex structure, which includes a fused imidazo-pyridine ring system and a benzodioxole moiety. This compound features a bromine atom and a nitro group, which contribute to its reactivity and potential biological activity. The presence of the benzodioxole group often indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The nitro group can enhance the compound's electrophilicity, while the bromine atom may serve as a site for further chemical modifications. This compound is likely to exhibit specific solubility characteristics, stability under certain conditions, and may participate in various chemical reactions, including nucleophilic substitutions or reductions. Its unique structural features suggest potential uses in research, particularly in the fields of organic synthesis and drug discovery. However, detailed studies would be necessary to fully understand its properties and applications.

Formula: C₁₄H₈BrN₃O₄

InChI: InChI=1/C14H8BrN3O4/c15-14-13(8-1-3-10-11(5-8)22-7-21-10)16-12-4-2-9(18(19)20)6-17(12)14/h1-6H,7H2

Synonyms:

• 2-(1,3-Benzodioxol-5-yl)-3-brom-6-nitroimidazo[1,2-a]pyridin

2-(1,3-Benzodioxol-5-yl)-3-bromo-6-nitroimidazo[1,2-a]pyridine

CAS: 904814-03-5

2-(1,3-Benzodioxol-5-yl)-3-bromo-6-nitroimidazo[1,2-a]pyridine

Purity: ≥95%

Ref: 54-OR11719