CymitQuimica logo

CAS 904814-36-4

:

N,N-dimethyl-4-piperazin-2-yl-aniline

Description:
N,N-Dimethyl-4-piperazin-2-yl-aniline is an organic compound characterized by its piperazine and aniline functional groups. It features a piperazine ring, which is a six-membered cyclic amine, substituted with a dimethyl group and an aniline moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of nitrogen atoms that can engage in hydrogen bonding. Its molecular structure suggests it may have basic properties, allowing it to interact with acids to form salts. The presence of both piperazine and aniline groups may contribute to its biological activity, making it of interest in pharmaceutical research. Additionally, the compound may exhibit moderate to high lipophilicity, influencing its pharmacokinetic properties. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper safety measures are taken during its use in laboratory or industrial settings.
Formula:C12H19N3
InChI:InChI=1/C12H19N3/c1-15(2)11-5-3-10(4-6-11)12-9-13-7-8-14-12/h3-6,12-14H,7-9H2,1-2H3
SMILES:CN(C)c1ccc(cc1)C1CNCCN1
Synonyms:
  • benzenamine, N,N-dimethyl-4-(2-piperazinyl)-
  • N,N-Dimethyl-4-(2-piperazinyl)anilin
  • N,N-Dimethyl-4-(2-piperazinyl)aniline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.