CAS 904815-32-3

N-[(1-aminocyclopentyl)methyl]acetamide

Description:

N-[(1-aminocyclopentyl)methyl]acetamide, with the CAS number 904815-32-3, is a chemical compound characterized by its amide functional group, which is indicative of its potential as a bioactive molecule. This compound features a cyclopentyl ring, which contributes to its structural rigidity and may influence its interaction with biological targets. The presence of an amino group suggests that it can participate in hydrogen bonding, enhancing its solubility in polar solvents and potentially affecting its pharmacokinetic properties. The acetamide moiety indicates that it may exhibit properties typical of amides, such as stability under physiological conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific receptors or enzymes. Additionally, the compound's unique structural features may confer selectivity and potency in biological assays. Overall, N-[(1-aminocyclopentyl)methyl]acetamide represents a compound of interest for further research in drug discovery and development.

Formula: C₈H₁₆N₂O

InChI: InChI=1/C8H16N2O/c1-7(11)10-6-8(9)4-2-3-5-8/h2-6,9H2,1H3,(H,10,11)

SMILES: CC(=NCC1(CCCC1)N)O

Synonyms:

• acetamide, N-[(1-aminocyclopentyl)methyl]-
• N-[(1-Aminocyclopentyl)methyl]acetamid

N-[(1-aminocyclopentyl)methyl]acetamide

CAS: 904815-32-3

Formula: C₈H₁₆N₂O

Purity: 95.0%

Molecular weight: 156.229

Ref: 10-F526299