CAS 904815-57-2

4-(2-methoxyphenyl)-2,3-dihydro-1H-1,5-benzodiazepine

Description:

4-(2-Methoxyphenyl)-2,3-dihydro-1H-1,5-benzodiazepine, identified by its CAS number 904815-57-2, is a chemical compound belonging to the benzodiazepine class, which is known for its psychoactive properties. This compound features a benzodiazepine core structure, characterized by a fused benzene and diazepine ring, which contributes to its biological activity. The presence of the 2-methoxyphenyl group enhances its lipophilicity, potentially influencing its pharmacokinetic properties, such as absorption and distribution in biological systems. The dihydro configuration indicates that the compound may exhibit unique reactivity and stability compared to fully saturated or unsaturated analogs. While specific biological activities and therapeutic applications may vary, compounds in this class are often investigated for their effects on the central nervous system, including anxiolytic, sedative, and anticonvulsant properties. As with many benzodiazepines, understanding the structure-activity relationship is crucial for predicting its behavior in medicinal chemistry and pharmacology.

Formula: C₁₆H₁₆N₂O

InChI: InChI=1/C16H16N2O/c1-19-16-9-5-2-6-12(16)13-10-11-17-14-7-3-4-8-15(14)18-13/h2-9,17H,10-11H2,1H3

SMILES: COc1ccccc1C1=Nc2ccccc2NCC1

Synonyms:

• 1H-1,5-benzodiazepine, 2,3-dihydro-4-(2-methoxyphenyl)-
• 4-(2-Methoxyphenyl)-2,3-dihydro-1H-1,5-benzodiazepin

4-(2-methoxyphenyl)-2,3-dihydro-1H-1,5-benzodiazepine

CAS: 904815-57-2

Purity: 95.0%

Molecular weight: 252.31700134277344

Ref: 10-F526308