CAS 904815-64-1

4-(3-methoxyphenyl)-2,3-dihydro-1H-1,5-benzodiazepine

Description:

4-(3-Methoxyphenyl)-2,3-dihydro-1H-1,5-benzodiazepine, identified by its CAS number 904815-64-1, is a chemical compound that belongs to the benzodiazepine class, which is known for its psychoactive properties. This compound features a benzodiazepine core structure, characterized by a fused benzene and diazepine ring, with a methoxyphenyl substituent that enhances its pharmacological profile. The presence of the methoxy group typically influences the compound's lipophilicity and can affect its interaction with biological targets, such as neurotransmitter receptors. The dihydro form indicates that it has two hydrogen atoms added to the benzodiazepine structure, which may impact its stability and reactivity. Compounds in this class are often studied for their potential therapeutic effects, including anxiolytic, sedative, and anticonvulsant properties. However, specific biological activities, solubility, and toxicity profiles would require further investigation through experimental studies and literature reviews to fully understand its characteristics and potential applications.

Formula: C₁₆H₁₆N₂O

InChI: InChI=1/C16H16N2O/c1-19-13-6-4-5-12(11-13)14-9-10-17-15-7-2-3-8-16(15)18-14/h2-8,11,17H,9-10H2,1H3

SMILES: COc1cccc(c1)C1=Nc2ccccc2NCC1

Synonyms:

• 1H-1,5-benzodiazepine, 2,3-dihydro-4-(3-methoxyphenyl)-
• 4-(3-Methoxyphenyl)-2,3-dihydro-1H-1,5-benzodiazepin

4-(3-methoxyphenyl)-2,3-dihydro-1H-1,5-benzodiazepine

CAS: 904815-64-1

Purity: 95.0%

Molecular weight: 252.31700134277344

Ref: 10-F526309