CAS 904815-76-5

2-(3-methoxyphenyl)-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine

Description:

2-(3-Methoxyphenyl)-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine is a chemical compound characterized by its unique structure, which includes a benzodiazepine core fused with a tetrahydro structure and a methoxyphenyl substituent. This compound typically exhibits properties associated with benzodiazepines, such as potential psychoactive effects, although specific biological activities can vary. The presence of the methoxy group may influence its solubility, lipophilicity, and interaction with biological targets. The compound's molecular structure suggests it may engage with neurotransmitter systems, potentially affecting anxiety, sleep, or other central nervous system functions. As with many benzodiazepines, it may also exhibit sedative, anxiolytic, or muscle relaxant properties. However, detailed pharmacological data, including efficacy and safety profiles, would require further investigation through empirical studies. The CAS number 904815-76-5 serves as a unique identifier for this compound, facilitating its recognition in chemical databases and literature.

Formula: C₁₆H₁₈N₂O

InChI: InChI=1/C16H18N2O/c1-19-13-6-4-5-12(11-13)14-9-10-17-15-7-2-3-8-16(15)18-14/h2-8,11,14,17-18H,9-10H2,1H3

SMILES: COc1cccc(c1)C1CCNc2ccccc2N1

Synonyms:

• 2-(3-Methoxyphenyl)-2,3,4,5-tetrahydro-1H-1,5-benzodiazepin

2-(3-methoxyphenyl)-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine

CAS: 904815-76-5

Purity: 95.0%

Molecular weight: 254.33299255371094

Ref: 10-F526312