CAS 904815-83-4

2-(4-methoxyphenyl)-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine

Description:

2-(4-Methoxyphenyl)-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine is a chemical compound characterized by its unique structure, which includes a benzodiazepine core fused with a tetrahydro structure and a methoxy-substituted phenyl group. This compound typically exhibits properties associated with benzodiazepines, such as potential psychoactive effects, though its specific biological activity can vary. The presence of the methoxy group may influence its lipophilicity and interaction with biological targets, potentially affecting its pharmacokinetics and pharmacodynamics. The compound is likely to be soluble in organic solvents and may have limited solubility in water, which is common for many organic compounds. Its molecular structure suggests it could interact with neurotransmitter systems, but detailed studies would be necessary to elucidate its specific effects and therapeutic potential. As with any chemical substance, safety and handling precautions should be observed, particularly in laboratory settings.

Formula: C₁₆H₁₈N₂O

InChI: InChI=1/C16H18N2O/c1-19-13-8-6-12(7-9-13)14-10-11-17-15-4-2-3-5-16(15)18-14/h2-9,14,17-18H,10-11H2,1H3

SMILES: COc1ccc(cc1)C1CCNc2ccccc2N1

Synonyms:

• 2-(4-Methoxyphenyl)-2,3,4,5-tetrahydro-1H-1,5-benzodiazepin

2-(4-methoxyphenyl)-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine

CAS: 904815-83-4

Purity: 95.0%

Molecular weight: 254.33299255371094

Ref: 10-F526313