CymitQuimica logo

CAS 904816-03-1

:

6-(azepan-2-yl)quinoline

Description:
6-(Azepan-2-yl)quinoline is a chemical compound characterized by its quinoline core, which is a bicyclic structure consisting of a benzene ring fused to a pyridine ring. The presence of the azepane group, a seven-membered saturated nitrogen-containing ring, at the 6-position of the quinoline structure introduces unique properties, including potential for diverse interactions in biological systems. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its molecular structure suggests it could participate in hydrogen bonding and hydrophobic interactions, influencing its solubility and reactivity. Additionally, the presence of the nitrogen atom in both the azepane and quinoline rings may contribute to its basicity and potential as a ligand in coordination chemistry. The compound's specific characteristics, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the environment in which it is studied. Overall, 6-(azepan-2-yl)quinoline represents a class of compounds that may have significant implications in drug development and chemical research.
Formula:C15H18N2
InChI:InChI=1/C15H18N2/c1-2-6-14(16-9-3-1)13-7-8-15-12(11-13)5-4-10-17-15/h4-5,7-8,10-11,14,16H,1-3,6,9H2
SMILES:C1CCC(c2ccc3c(cccn3)c2)NCC1
Synonyms:
  • 6-(2-Azepanyl)chinolin
  • 6-(2-Azepanyl)quinoline
  • quinoline, 6-(hexahydro-1H-azepin-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.