CAS 904816-06-4

2-({3-[(tert-butoxycarbonyl)amino]propyl}amino)pyridine-3-carboxylic acid

Description:

2-({3-[(tert-butoxycarbonyl)amino]propyl}amino)pyridine-3-carboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a carboxylic acid group and an amino group. The presence of the tert-butoxycarbonyl (Boc) protecting group indicates that the amino group is likely involved in further chemical reactions or modifications. This compound is typically used in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. Its solubility properties may vary depending on the pH of the solution, as the carboxylic acid can ionize, affecting its overall polarity and solubility in aqueous environments. The compound's molecular interactions are influenced by hydrogen bonding capabilities due to the amino and carboxylic acid functional groups, which can play a significant role in its biological activity and reactivity. Overall, this compound exemplifies the complexity and versatility of organic molecules used in advanced chemical applications.

Formula: C₁₄H₂₁N₃O₄

InChI: InChI=1/C14H21N3O4/c1-14(2,3)21-13(20)17-9-5-8-16-11-10(12(18)19)6-4-7-15-11/h4,6-7H,5,8-9H2,1-3H3,(H,15,16)(H,17,20)(H,18,19)

SMILES: CC(C)(C)OC(=NCCCNc1c(cccn1)C(=O)O)O

Synonyms:

• 2-({3-[(tert-Butoxycarbonyl)amino]propyl}amino)nicotinic acid
• 2-{[3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)propyl]amino}nicotinic acid
• 3-Pyridinecarboxylic Acid, 2-[[3-[[(1,1-Dimethylethoxy)Carbonyl]Amino]Propyl]Amino]-

2-[(3-{[(tert-butoxy)carbonyl]amino}propyl)amino]pyridine-3-carboxylic acid

CAS: 904816-06-4

Formula: C₁₄H₂₁N₃O₄

Purity: 95.0%

Molecular weight: 295.339

Ref: 10-F526196