CAS 904816-11-1

2-({4-[(tert-butoxycarbonyl)amino]butyl}amino)pyridine-3-carboxylic acid

Description:

2-({4-[(tert-butoxycarbonyl)amino]butyl}amino)pyridine-3-carboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a carboxylic acid group and an amino group. The presence of a tert-butoxycarbonyl (Boc) protecting group indicates that the compound is likely used in peptide synthesis or as an intermediate in organic synthesis. The amino group is attached to a butyl chain, which contributes to the compound's hydrophobic characteristics, while the carboxylic acid group provides acidic properties, making it soluble in polar solvents. This compound may exhibit biological activity due to its amino and carboxylic acid functionalities, potentially interacting with biological targets. Its molecular structure suggests it could be involved in various chemical reactions, including coupling reactions and deprotection processes. Overall, this compound is of interest in medicinal chemistry and organic synthesis due to its functional groups and potential applications in drug development.

Formula: C₁₅H₂₃N₃O₄

InChI: InChI=1/C15H23N3O4/c1-15(2,3)22-14(21)18-9-5-4-8-16-12-11(13(19)20)7-6-10-17-12/h6-7,10H,4-5,8-9H2,1-3H3,(H,16,17)(H,18,21)(H,19,20)

SMILES: CC(C)(C)OC(=NCCCCNc1c(cccn1)C(=O)O)O

Synonyms:

• 2-({4-[(tert-Butoxycarbonyl)amino]butyl}amino)nicotinic acid
• 2-{[4-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)butyl]amino}nicotinic acid
• 3-Pyridinecarboxylic Acid, 2-[[4-[[(1,1-Dimethylethoxy)Carbonyl]Amino]Butyl]Amino]-

2-[(4-{[(tert-butoxy)carbonyl]amino}butyl)amino]pyridine-3-carboxylic acid

CAS: 904816-11-1

Formula: C₁₅H₂₃N₃O₄

Purity: 95.0%

Molecular weight: 309.366

Ref: 10-F526197