CAS 904816-22-4
:2-(4-chlorophenyl)-1,3-diazaspiro[4.4]non-1-en-4-one
Description:
2-(4-Chlorophenyl)-1,3-diazaspiro[4.4]non-1-en-4-one is a chemical compound characterized by its unique spirocyclic structure, which includes a diazine moiety and a chlorophenyl substituent. The presence of the spiro system contributes to its rigidity and potential biological activity. This compound features a non-enone functional group, which may influence its reactivity and interactions with biological targets. The chlorophenyl group enhances lipophilicity, potentially affecting its pharmacokinetic properties. As a diazaspiro compound, it may exhibit interesting conformational properties and could be of interest in medicinal chemistry for its potential therapeutic applications. The compound's CAS number, 904816-22-4, allows for easy identification in chemical databases and literature. Overall, the structural features of 2-(4-chlorophenyl)-1,3-diazaspiro[4.4]non-1-en-4-one suggest it may possess unique chemical and biological properties, making it a candidate for further research in various fields, including drug discovery and materials science.
Formula:C13H13ClN2O
InChI:InChI=1/C13H13ClN2O/c14-10-5-3-9(4-6-10)11-15-12(17)13(16-11)7-1-2-8-13/h3-6H,1-2,7-8H2,(H,15,16,17)
SMILES:C1CCC2(C1)C(=O)N=C(c1ccc(cc1)Cl)N2
Synonyms:- 1,3-Diazaspiro[4.4]Non-1-En-4-One, 2-(4-Chlorophenyl)-
- 2-(4-Chlorphenyl)-1,3-diazaspiro[4.4]non-1-en-4-on
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.