CymitQuimica logo

CAS 904816-43-9

:

1-[[2-(1,3-benzodioxol-5-yl)imidazo[3,2-a]pyridin-3-yl]methyl]piperidine-3-carboxylic acid

Description:
1-[[2-(1,3-benzodioxol-5-yl)imidazo[3,2-a]pyridin-3-yl]methyl]piperidine-3-carboxylic acid is a complex organic compound characterized by its unique structural features, which include a piperidine ring, an imidazo[3,2-a]pyridine moiety, and a benzodioxole group. This compound is typically classified as a heterocyclic compound due to the presence of nitrogen atoms in its ring structures. It exhibits potential biological activity, making it of interest in medicinal chemistry and pharmacology. The presence of the carboxylic acid functional group suggests it may engage in hydrogen bonding and participate in various chemical reactions, influencing its solubility and reactivity. Additionally, the compound's intricate structure may contribute to its specificity in biological interactions, potentially impacting its efficacy as a pharmaceutical agent. Overall, this substance represents a class of compounds that may have applications in drug development, particularly in targeting specific biological pathways or receptors.
Formula:C21H21N3O4
InChI:InChI=1/C21H21N3O4/c25-21(26)15-4-3-8-23(11-15)12-16-20(22-19-5-1-2-9-24(16)19)14-6-7-17-18(10-14)28-13-27-17/h1-2,5-7,9-10,15H,3-4,8,11-13H2,(H,25,26)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.