CymitQuimica logo

CAS 904816-50-8

:

1-[[2-(1,3-benzodioxol-5-yl)imidazo[3,2-a]pyrimidin-3-yl]methyl]piperidine-3-carboxylic acid

Description:
1-[[2-(1,3-benzodioxol-5-yl)imidazo[3,2-a]pyrimidin-3-yl]methyl]piperidine-3-carboxylic acid, with CAS number 904816-50-8, is a chemical compound characterized by its complex structure, which includes a piperidine ring, an imidazopyrimidine moiety, and a benzodioxole group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the piperidine and imidazopyrimidine rings suggests that it may interact with biological targets, possibly influencing various signaling pathways. Its carboxylic acid functional group can participate in hydrogen bonding and may enhance its solubility in polar solvents. The compound's intricate structure may also contribute to its pharmacological properties, which could include effects on the central nervous system or other therapeutic areas. Overall, this compound represents a class of heterocyclic compounds that are often explored for their potential applications in drug development.
Formula:C20H20N4O4
InChI:InChI=1/C20H20N4O4/c25-19(26)14-3-1-7-23(10-14)11-15-18(22-20-21-6-2-8-24(15)20)13-4-5-16-17(9-13)28-12-27-16/h2,4-6,8-9,14H,1,3,7,10-12H2,(H,25,26)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.