CAS 904816-56-4

2-(1,3-benzodioxol-5-yl)-3-nitro-imidazo[1,2-a]pyrimidine

Description:

2-(1,3-benzodioxol-5-yl)-3-nitro-imidazo[1,2-a]pyrimidine is a chemical compound characterized by its complex structure, which includes a nitro group and a fused imidazo-pyrimidine ring system. The presence of the 1,3-benzodioxole moiety contributes to its aromatic properties and potential for engaging in π-π interactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its nitro group can participate in electrophilic reactions, while the imidazo and pyrimidine rings may influence its biological activity and reactivity. Such compounds are often studied for their potential pharmacological properties, including antimicrobial or anticancer activities. The specific interactions and stability of this compound can be influenced by factors such as pH, solvent, and temperature. As with many heterocyclic compounds, it may also exhibit interesting electronic properties due to the delocalization of electrons within its aromatic systems.

Formula: C₁₃H₈N₄O₄

InChI: InChI=1/C13H8N4O4/c18-17(19)12-11(15-13-14-4-1-5-16(12)13)8-2-3-9-10(6-8)21-7-20-9/h1-6H,7H2

Synonyms:

• 2-(1,3-Benzodioxol-5-yl)-3-nitroimidazo[1,2-a]pyrimidin
• 2-(1,3-Benzodioxol-5-yl)-3-nitroimidazo[1,2-a]pyrimidine
• imidazo[1,2-a]pyrimidine, 2-(1,3-benzodioxol-5-yl)-3-nitro-