CAS 904817-05-6
:2-(4-dimethylaminophenyl)-3H-benzimidazole-5-carboxylic acid
Description:
2-(4-Dimethylaminophenyl)-3H-benzimidazole-5-carboxylic acid is a chemical compound characterized by its complex structure, which includes a benzimidazole core substituted with a dimethylaminophenyl group and a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential fluorescence and varied solubility depending on the solvent used. The presence of the dimethylamino group can enhance its electron-donating capabilities, influencing its reactivity and interactions in biological systems. The carboxylic acid group contributes to its acidity and potential for forming salts or esters. This compound may be of interest in pharmaceutical research due to its structural features, which could be relevant for drug design or as a probe in biochemical assays. Additionally, its unique properties may allow for applications in materials science or organic synthesis. As with many organic compounds, safety and handling precautions should be observed, given the potential for toxicity or reactivity.
Formula:C16H15N3O2
InChI:InChI=1/C16H15N3O2/c1-19(2)12-6-3-10(4-7-12)15-17-13-8-5-11(16(20)21)9-14(13)18-15/h3-9H,1-2H3,(H,17,18)(H,20,21)
Synonyms:- 1H-Benzimidazole-6-carboxylic acid, 2-[4-(dimethylamino)phenyl]-
- 2-[4-(dimethylamino)phenyl]-1H-1,3-benzodiazole-6-carboxylic acid
- 2-(4-Dimethylaminophenyl)-1H-benzimidazole-5-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.