CymitQuimica logo

CAS 904817-12-5

:

2-(2-hydroxyphenyl)-3H-benzimidazole-4-carboxylic acid

Description:
2-(2-Hydroxyphenyl)-3H-benzimidazole-4-carboxylic acid, with the CAS number 904817-12-5, is a chemical compound characterized by its unique structural features, which include a benzimidazole core substituted with a hydroxyl group and a carboxylic acid functional group. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the hydroxyl and carboxylic acid groups, which can engage in hydrogen bonding. It may also display acidic behavior due to the carboxylic acid moiety, making it relevant in various chemical reactions and applications. The presence of the benzimidazole structure suggests potential biological activity, as many benzimidazole derivatives are known for their pharmacological properties. Additionally, this compound may be of interest in materials science or organic synthesis due to its ability to form coordination complexes or serve as a ligand. Overall, its unique functional groups and structural characteristics contribute to its potential utility in various fields, including medicinal chemistry and materials development.
Formula:C14H10N2O3
InChI:InChI=1/C14H10N2O3/c17-11-7-2-1-4-8(11)13-15-10-6-3-5-9(14(18)19)12(10)16-13/h1-7,17H,(H,15,16)(H,18,19)
Synonyms:
  • 2-(2-Hydroxyphenyl)-1H-benzimidazole-7-carboxylic acid
  • 2-(2-Hydroxyphenyl)-1H-benzimidazole-4-carboxylic acid
  • 1H-benzimidazole-7-carboxylic acid, 2-(2-hydroxyphenyl)-
  • 2-(2-HYDROXY-PHENYL)-3H-BENZOIMIDAZOLE-4-CARBOXYLIC ACID
  • 2-(2-hydroxyphenyl)-1H-1,3-benzodiazole-7-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.