CAS 904817-29-4
:1-[[2-(2-furyl)imidazo[3,2-a]pyridin-3-yl]methyl]piperidine-4-carboxylic acid
Description:
1-[[2-(2-furyl)imidazo[3,2-a]pyridin-3-yl]methyl]piperidine-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes a piperidine ring, an imidazo-pyridine moiety, and a furyl group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to its ability to interact with various biological targets. The presence of the carboxylic acid functional group suggests it may exhibit acidic properties and participate in hydrogen bonding, influencing its solubility and reactivity. The imidazo[3,2-a]pyridine structure is known for its role in medicinal chemistry, often contributing to pharmacological activities. Additionally, the furyl group can enhance the compound's lipophilicity, potentially affecting its bioavailability. Overall, this compound may be of interest in drug discovery and development, particularly in the context of targeting specific receptors or enzymes in biological systems. Its unique structural features make it a candidate for further investigation in various chemical and biological applications.
Formula:C18H19N3O3
InChI:InChI=1/C18H19N3O3/c22-18(23)13-6-9-20(10-7-13)12-14-17(15-4-3-11-24-15)19-16-5-1-2-8-21(14)16/h1-5,8,11,13H,6-7,9-10,12H2,(H,22,23)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.