CAS 904817-57-8

8a-(4-fluorophenyl)-2,3,4,6,7,8-hexahydro-1H-pyrrolo[1,2-a]pyrimidine

Description:

8a-(4-fluorophenyl)-2,3,4,6,7,8-hexahydro-1H-pyrrolo[1,2-a]pyrimidine is a chemical compound characterized by its complex bicyclic structure, which includes a pyrrolopyrimidine framework. This compound features a fluorophenyl substituent, which can influence its biological activity and solubility properties. The presence of the fluorine atom typically enhances lipophilicity and can affect the compound's interaction with biological targets. The hexahydro component indicates that the compound is saturated, contributing to its stability and potentially influencing its reactivity. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and spectral data, would be determined through experimental methods. As with many organic compounds, its behavior in biological systems would depend on various factors, including its stereochemistry and the presence of functional groups. Overall, this compound represents a class of heterocyclic compounds that are of interest in drug discovery and development.

Formula: C₁₃H₁₇FN₂

InChI: InChI=1/C13H17FN2/c14-12-5-3-11(4-6-12)13-7-1-9-16(13)10-2-8-15-13/h3-6,15H,1-2,7-10H2

SMILES: C1CC2(c3ccc(cc3)F)NCCCN2C1

Synonyms:

• 8a-(4-Fluorophenyl)octahydropyrrolo[1,2-a]pyrimidine
• 8a-(4-Fluorphenyl)octahydropyrrolo[1,2-a]pyrimidin
• Pyrrolo[1,2-A]Pyrimidine, 8A-(4-Fluorophenyl)Octahydro-