CAS 904817-70-5

6-(4-tert-butoxycarbonyl-3-methyl-piperazin-1-yl)pyridine-3-carboxylic acid

Description:

6-(4-tert-butoxycarbonyl-3-methyl-piperazin-1-yl)pyridine-3-carboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a carboxylic acid group and a piperazine moiety. The tert-butoxycarbonyl (Boc) group serves as a protective group for the amine in the piperazine, enhancing the compound's stability and solubility in organic solvents. This compound is typically used in medicinal chemistry and drug development due to its potential biological activity, particularly in the context of targeting specific receptors or enzymes. Its molecular structure suggests it may exhibit properties such as moderate polarity, which can influence its interactions in biological systems. The presence of both basic (from the piperazine) and acidic (from the carboxylic acid) functional groups allows for diverse reactivity and potential for forming salts or complexes. Overall, this compound exemplifies the intricate design often found in pharmaceutical agents, balancing lipophilicity and hydrophilicity for optimal biological performance.

Formula: C₁₆H₂₃N₃O₄

InChI: InChI=1/C16H23N3O4/c1-11-10-18(13-6-5-12(9-17-13)14(20)21)7-8-19(11)15(22)23-16(2,3)4/h5-6,9,11H,7-8,10H2,1-4H3,(H,20,21)

SMILES: CC1CN(CCN1C(=O)OC(C)(C)C)c1ccc(cn1)C(=O)O

6-{4-[(tert-butoxy)carbonyl]-3-methylpiperazin-1-yl}pyridine-3-carboxylic acid

CAS: 904817-70-5

Formula: C₁₆H₂₃N₃O₄

Purity: 95.0%

Molecular weight: 321.377

Ref: 10-F526223