CAS 904817-78-3

2-[4-(tert-butoxycarbonyl)-3-methylpiperazin-1-yl]pyridine-3-carboxylic acid

Description:

2-[4-(tert-butoxycarbonyl)-3-methylpiperazin-1-yl]pyridine-3-carboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring, a carboxylic acid functional group, and a piperazine moiety with a tert-butoxycarbonyl (Boc) protecting group. This compound typically exhibits properties associated with both basic and acidic functionalities due to the presence of the carboxylic acid group and the nitrogen atoms in the piperazine ring. It is likely to be soluble in polar organic solvents and may exhibit moderate stability under standard laboratory conditions. The tert-butoxycarbonyl group serves as a protective group for the amine, allowing for selective reactions in synthetic chemistry. This compound may be of interest in medicinal chemistry and drug development, particularly in the design of pharmacologically active agents due to its potential interactions with biological targets. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular conformation.

Formula: C₁₆H₂₃N₃O₄

InChI: InChI=1/C16H23N3O4/c1-11-10-18(13-12(14(20)21)6-5-7-17-13)8-9-19(11)15(22)23-16(2,3)4/h5-7,11H,8-10H2,1-4H3,(H,20,21)

SMILES: CC1CN(CCN1C(=O)OC(C)(C)C)c1c(cccn1)C(=O)O

Synonyms:

• 1-Piperazinecarboxylic Acid, 4-(3-Carboxy-2-Pyridinyl)-2-Methyl-, 1-(1,1-Dimethylethyl) Ester
• 2-(3-Methyl-4-{[(2-methyl-2-propanyl)oxy]carbonyl}-1-piperazinyl)nicotinic acid
• 2-[4-(tert-Butoxycarbonyl)-3-methylpiperazin-1-yl]nicotinic acid

2-{4-[(tert-butoxy)carbonyl]-3-methylpiperazin-1-yl}pyridine-3-carboxylic acid

CAS: 904817-78-3

Formula: C₁₆H₂₃N₃O₄

Purity: 95.0%

Molecular weight: 321.377

Ref: 10-F526224